C6H5ClF2N2O — CID 130102466
6-amino-3-chloro-2-(difluoromethyl)-1H-pyridin-4-one (PubChem CID 130102466) has the molecular formula C6H5ClF2N2O and a molecular weight of 194.57 g/mol. Its IUPAC name is 6-amino-3-chloro-2-(difluoromethyl)-1H-pyridin-4-one.
| Compound Name | 6-amino-3-chloro-2-(difluoromethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 130102466 |
| Molecular Formula | C6H5ClF2N2O |
| Molecular Weight | 194.57 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 6-amino-3-chloro-2-(difluoromethyl)-1H-pyridin-4-one |
| SMILES | Nc1cc(=O)c(Cl)c(C(F)F)[nH]1 |
| InChI | InChI=1S/C6H5ClF2N2O/c7-4-2(12)1-3(10)11-5(4)6(8)9/h1,6H,(H3,10,11,12) |
| InChIKey | AVTPMHNETDPRRO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.57 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |