C6H3Cl2F2NO — CID 130099225
4,5-dichloro-6-(difluoromethyl)-1H-pyridin-2-one (PubChem CID 130099225) has the molecular formula C6H3Cl2F2NO and a molecular weight of 214.00 g/mol. Its IUPAC name is 4,5-dichloro-6-(difluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4,5-dichloro-6-(difluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130099225 |
| Molecular Formula | C6H3Cl2F2NO |
| Molecular Weight | 214.00 g/mol |
| Exact Mass | 212.96 |
| IUPAC Name | 4,5-dichloro-6-(difluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(Cl)c(Cl)c(C(F)F)[nH]1 |
| InChI | InChI=1S/C6H3Cl2F2NO/c7-2-1-3(12)11-5(4(2)8)6(9)10/h1,6H,(H,11,12) |
| InChIKey | XCEVJTQUYYPXNU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.00 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |