C7H5F5N2O — CID 130104763
6-amino-3-(difluoromethyl)-5-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 130104763) has the molecular formula C7H5F5N2O and a molecular weight of 228.12 g/mol. Its IUPAC name is 6-amino-3-(difluoromethyl)-5-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-amino-3-(difluoromethyl)-5-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130104763 |
| Molecular Formula | C7H5F5N2O |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 6-amino-3-(difluoromethyl)-5-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Nc1[nH]c(=O)c(C(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C7H5F5N2O/c8-4(9)2-1-3(7(10,11)12)5(13)14-6(2)15/h1,4H,(H3,13,14,15) |
| InChIKey | GEYDUYHEHZLJEL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |