C9H8F3N3 — CID 162553480
2-methyl-6-(trifluoromethyl)-1H-benzimidazol-5-amine (PubChem CID 162553480) has the molecular formula C9H8F3N3 and a molecular weight of 215.18 g/mol. Its IUPAC name is 2-methyl-6-(trifluoromethyl)-1H-benzimidazol-5-amine.
| Compound Name | 2-methyl-6-(trifluoromethyl)-1H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 162553480 |
| Molecular Formula | C9H8F3N3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-methyl-6-(trifluoromethyl)-1H-benzimidazol-5-amine |
| SMILES | Cc1nc2cc(N)c(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C9H8F3N3/c1-4-14-7-2-5(9(10,11)12)6(13)3-8(7)15-4/h2-3H,13H2,1H3,(H,14,15) |
| InChIKey | SIRBJUKOLLDEMX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|