C9H10FN3 — CID 149051203
(6-fluoro-2-methyl-3H-benzimidazol-5-yl)methanamine (PubChem CID 149051203) has the molecular formula C9H10FN3 and a molecular weight of 179.20 g/mol. Its IUPAC name is (6-fluoro-2-methyl-3H-benzimidazol-5-yl)methanamine.
| Compound Name | (6-fluoro-2-methyl-3H-benzimidazol-5-yl)methanamine |
|---|---|
| PubChem CID | 149051203 |
| Molecular Formula | C9H10FN3 |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (6-fluoro-2-methyl-3H-benzimidazol-5-yl)methanamine |
| SMILES | Cc1nc2cc(F)c(CN)cc2[nH]1 |
| InChI | InChI=1S/C9H10FN3/c1-5-12-8-2-6(4-11)7(10)3-9(8)13-5/h2-3H,4,11H2,1H3,(H,12,13) |
| InChIKey | QJVYFGLEDCXEEW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |