About ethane;6-fluoro-2-methyl-1H-benzimidazole
ethane;6-fluoro-2-methyl-1H-benzimidazole (PubChem CID 142961640) has the molecular formula C10H13FN2
and a molecular weight of 180.23 g/mol. Its IUPAC name is ethane;6-fluoro-2-methyl-1H-benzimidazole.
Molecular Properties
| Compound Name | ethane;6-fluoro-2-methyl-1H-benzimidazole |
| PubChem CID | 142961640 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | ethane;6-fluoro-2-methyl-1H-benzimidazole |
| SMILES | CC.Cc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C8H7FN2.C2H6/c1-5-10-7-3-2-6(9)4-8(7)11-5;1-2/h2-4H,1H3,(H,10,11);1-2H3 |
| InChIKey | MDFPKYUAFVUGCF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-fluoro-2-methyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-fluoro-2-methyl-1H-benzimidazole?
The IUPAC name of ethane;6-fluoro-2-methyl-1H-benzimidazole (CID 142961640) is ethane;6-fluoro-2-methyl-1H-benzimidazole.
What is the SMILES notation for ethane;6-fluoro-2-methyl-1H-benzimidazole?
The canonical SMILES for ethane;6-fluoro-2-methyl-1H-benzimidazole is CC.Cc1nc2ccc(F)cc2[nH]1.
What is the InChIKey of ethane;6-fluoro-2-methyl-1H-benzimidazole?
The InChIKey is MDFPKYUAFVUGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2.C2H6/c1-5-10-7-3-2-6(9)4-8(7)11-5;1-2/h2-4H,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;6-fluoro-2-methyl-1H-benzimidazole?
ethane;6-fluoro-2-methyl-1H-benzimidazole has a molecular weight of 180.23 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-fluoro-2-methyl-1H-benzimidazole is sourced from PubChem (CID 142961640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).