C12H17BrN2 — CID 90818369
6-(2-bromoethyl)-2-methyl-1H-benzimidazole;ethane (PubChem CID 90818369) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is 6-(2-bromoethyl)-2-methyl-1H-benzimidazole;ethane.
| Compound Name | 6-(2-bromoethyl)-2-methyl-1H-benzimidazole;ethane |
|---|---|
| PubChem CID | 90818369 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 6-(2-bromoethyl)-2-methyl-1H-benzimidazole;ethane |
| SMILES | CC.Cc1nc2ccc(CCBr)cc2[nH]1 |
| InChI | InChI=1S/C10H11BrN2.C2H6/c1-7-12-9-3-2-8(4-5-11)6-10(9)13-7;1-2/h2-3,6H,4-5H2,1H3,(H,12,13);1-2H3 |
| InChIKey | NAVBAEXEVQKZFF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|