C12H15N3OS — CID 115167417
N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]-2-sulfanylacetamide (PubChem CID 115167417) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167417 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]-2-sulfanylacetamide |
| SMILES | Cc1nc2ccc(CCNC(=O)CS)cc2[nH]1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-14-10-3-2-9(6-11(10)15-8)4-5-13-12(16)7-17/h2-3,6,17H,4-5,7H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | SCOOSVGICSAUTH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|