C13H19N3S — CID 115224402
2-[methyl-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]amino]ethanethiol (PubChem CID 115224402) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-[methyl-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]amino]ethanethiol.
| Compound Name | 2-[methyl-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]amino]ethanethiol |
|---|---|
| PubChem CID | 115224402 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[methyl-[2-(2-methyl-3H-benzimidazol-5-yl)ethyl]amino]ethanethiol |
| SMILES | Cc1nc2ccc(CCN(C)CCS)cc2[nH]1 |
| InChI | InChI=1S/C13H19N3S/c1-10-14-12-4-3-11(9-13(12)15-10)5-6-16(2)7-8-17/h3-4,9,17H,5-8H2,1-2H3,(H,14,15) |
| InChIKey | PEHMWFLOVURDOS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|