C9H9FN2O — CID 17010542
1-(6-fluoro-1H-benzimidazol-2-yl)ethanol (PubChem CID 17010542) has the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. Its IUPAC name is 1-(6-fluoro-1H-benzimidazol-2-yl)ethanol.
| Compound Name | 1-(6-fluoro-1H-benzimidazol-2-yl)ethanol |
|---|---|
| PubChem CID | 17010542 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 1-(6-fluoro-1H-benzimidazol-2-yl)ethanol |
| SMILES | CC(O)c1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C9H9FN2O/c1-5(13)9-11-7-3-2-6(10)4-8(7)12-9/h2-5,13H,1H3,(H,11,12) |
| InChIKey | ULJPNPBJWAUTHU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |