C9H7F3N4O — CID 172562577
6-(trifluoromethyl)-1H-benzimidazole-2-carbohydrazide (PubChem CID 172562577) has the molecular formula C9H7F3N4O and a molecular weight of 244.18 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1H-benzimidazole-2-carbohydrazide.
| Compound Name | 6-(trifluoromethyl)-1H-benzimidazole-2-carbohydrazide |
|---|---|
| PubChem CID | 172562577 |
| Molecular Formula | C9H7F3N4O |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 6-(trifluoromethyl)-1H-benzimidazole-2-carbohydrazide |
| SMILES | NNC(=O)c1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C9H7F3N4O/c10-9(11,12)4-1-2-5-6(3-4)15-7(14-5)8(17)16-13/h1-3H,13H2,(H,14,15)(H,16,17) |
| InChIKey | WXRPCGPIZGNVLT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|