C15H18F3N3O2 — CID 140657671
[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl N-tert-butyl-N-methylcarbamate (PubChem CID 140657671) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is [6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl N-tert-butyl-N-methylcarbamate.
| Compound Name | [6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl N-tert-butyl-N-methylcarbamate |
|---|---|
| PubChem CID | 140657671 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl N-tert-butyl-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1nc2ccc(C(F)(F)F)cc2[nH]1)C(C)(C)C |
| InChI | InChI=1S/C15H18F3N3O2/c1-14(2,3)21(4)13(22)23-8-12-19-10-6-5-9(15(16,17)18)7-11(10)20-12/h5-7H,8H2,1-4H3,(H,19,20) |
| InChIKey | RWEAUGVSOWSWSH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |