C12H14F3N3 — CID 81456799
N-ethyl-2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine (PubChem CID 81456799) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is N-ethyl-2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine.
| Compound Name | N-ethyl-2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 81456799 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-ethyl-2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethanamine |
| SMILES | CCNCCc1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C12H14F3N3/c1-2-16-6-5-11-17-9-4-3-8(12(13,14)15)7-10(9)18-11/h3-4,7,16H,2,5-6H2,1H3,(H,17,18) |
| InChIKey | JNHBHZJZQSWUTB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|