C17H15F4N3 — CID 134084513
2-(3-fluorophenyl)-N-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl]ethanamine (PubChem CID 134084513) has the molecular formula C17H15F4N3 and a molecular weight of 337.32 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl]ethanamine.
| Compound Name | 2-(3-fluorophenyl)-N-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 134084513 |
| Molecular Formula | C17H15F4N3 |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]methyl]ethanamine |
| SMILES | Fc1cccc(CCNCc2nc3ccc(C(F)(F)F)cc3[nH]2)c1 |
| InChI | InChI=1S/C17H15F4N3/c18-13-3-1-2-11(8-13)6-7-22-10-16-23-14-5-4-12(17(19,20)21)9-15(14)24-16/h1-5,8-9,22H,6-7,10H2,(H,23,24) |
| InChIKey | JLQQXNIJQOSIGW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|