C12H14F3N3S — CID 84617046
2-methyl-1-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]propan-2-amine (PubChem CID 84617046) has the molecular formula C12H14F3N3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-methyl-1-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]propan-2-amine.
| Compound Name | 2-methyl-1-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]propan-2-amine |
|---|---|
| PubChem CID | 84617046 |
| Molecular Formula | C12H14F3N3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-methyl-1-[[6-(trifluoromethyl)-1H-benzimidazol-2-yl]sulfanyl]propan-2-amine |
| SMILES | CC(C)(N)CSc1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C12H14F3N3S/c1-11(2,16)6-19-10-17-8-4-3-7(12(13,14)15)5-9(8)18-10/h3-5H,6,16H2,1-2H3,(H,17,18) |
| InChIKey | PGDDBSPAAYOYEJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |