C10H12N4S — CID 112645841
2-(azetidin-3-ylsulfanyl)-3H-benzimidazol-5-amine (PubChem CID 112645841) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-(azetidin-3-ylsulfanyl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(azetidin-3-ylsulfanyl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 112645841 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(azetidin-3-ylsulfanyl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(SC3CNC3)[nH]c2c1 |
| InChI | InChI=1S/C10H12N4S/c11-6-1-2-8-9(3-6)14-10(13-8)15-7-4-12-5-7/h1-3,7,12H,4-5,11H2,(H,13,14) |
| InChIKey | LXZOEJWOOWGFON-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|