C12H15N3OS — CID 107747619
2-(2-methyloxolan-3-yl)sulfanyl-3H-benzimidazol-5-amine (PubChem CID 107747619) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(2-methyloxolan-3-yl)sulfanyl-3H-benzimidazol-5-amine.
| Compound Name | 2-(2-methyloxolan-3-yl)sulfanyl-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 107747619 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-(2-methyloxolan-3-yl)sulfanyl-3H-benzimidazol-5-amine |
| SMILES | CC1OCCC1Sc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C12H15N3OS/c1-7-11(4-5-16-7)17-12-14-9-3-2-8(13)6-10(9)15-12/h2-3,6-7,11H,4-5,13H2,1H3,(H,14,15) |
| InChIKey | SNWRZMGIKDNTPY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|