C15H19N5S — CID 64777268
2-[(1-butan-2-ylpyrazol-3-yl)methylsulfanyl]-3H-benzimidazol-5-amine (PubChem CID 64777268) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 2-[(1-butan-2-ylpyrazol-3-yl)methylsulfanyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[(1-butan-2-ylpyrazol-3-yl)methylsulfanyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 64777268 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[(1-butan-2-ylpyrazol-3-yl)methylsulfanyl]-3H-benzimidazol-5-amine |
| SMILES | CCC(C)n1ccc(CSc2nc3ccc(N)cc3[nH]2)n1 |
| InChI | InChI=1S/C15H19N5S/c1-3-10(2)20-7-6-12(19-20)9-21-15-17-13-5-4-11(16)8-14(13)18-15/h4-8,10H,3,9,16H2,1-2H3,(H,17,18) |
| InChIKey | RYRUOUBKVLMMTJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|