C10H12F2N2OS — CID 61357517
2-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethylacetamide (PubChem CID 61357517) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethylacetamide.
| Compound Name | 2-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 61357517 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(4-amino-2,6-difluorophenyl)sulfanyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CSc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H12F2N2OS/c1-14(2)9(15)5-16-10-7(11)3-6(13)4-8(10)12/h3-4H,5,13H2,1-2H3 |
| InChIKey | DXRNZELBAMLQMN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|