C11H11F2NOS — CID 81294069
3,5-difluoro-4-(4-hydroxybutan-2-ylsulfanyl)benzonitrile (PubChem CID 81294069) has the molecular formula C11H11F2NOS and a molecular weight of 243.28 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-hydroxybutan-2-ylsulfanyl)benzonitrile.
| Compound Name | 3,5-difluoro-4-(4-hydroxybutan-2-ylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 81294069 |
| Molecular Formula | C11H11F2NOS |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3,5-difluoro-4-(4-hydroxybutan-2-ylsulfanyl)benzonitrile |
| SMILES | CC(CCO)Sc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C11H11F2NOS/c1-7(2-3-15)16-11-9(12)4-8(6-14)5-10(11)13/h4-5,7,15H,2-3H2,1H3 |
| InChIKey | UHJRCBGSSARGIZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |