C22H16F4 — CID 157198263
methane;1,2,3-trifluoro-5-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]benzene (PubChem CID 157198263) has the molecular formula C22H16F4 and a molecular weight of 356.36 g/mol. Its IUPAC name is methane;1,2,3-trifluoro-5-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]benzene.
| Compound Name | methane;1,2,3-trifluoro-5-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 157198263 |
| Molecular Formula | C22H16F4 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | methane;1,2,3-trifluoro-5-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]benzene |
| SMILES | C.Cc1ccc(-c2ccc(C#Cc3cc(F)c(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C21H12F4.CH4/c1-13-2-5-15(6-3-13)17-9-8-16(18(22)12-17)7-4-14-10-19(23)21(25)20(24)11-14;/h2-3,5-6,8-12H,1H3;1H4 |
| InChIKey | AQMPWJPOCMWCAW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|