C16H10F4 — CID 143727078
2-fluoro-4-(4-methylphenyl)-1-(3,3,3-trifluoroprop-1-ynyl)benzene (PubChem CID 143727078) has the molecular formula C16H10F4 and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-fluoro-4-(4-methylphenyl)-1-(3,3,3-trifluoroprop-1-ynyl)benzene.
| Compound Name | 2-fluoro-4-(4-methylphenyl)-1-(3,3,3-trifluoroprop-1-ynyl)benzene |
|---|---|
| PubChem CID | 143727078 |
| Molecular Formula | C16H10F4 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-fluoro-4-(4-methylphenyl)-1-(3,3,3-trifluoroprop-1-ynyl)benzene |
| SMILES | Cc1ccc(-c2ccc(C#CC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H10F4/c1-11-2-4-12(5-3-11)14-7-6-13(15(17)10-14)8-9-16(18,19)20/h2-7,10H,1H3 |
| InChIKey | RXNNPVYBKUGRAT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|