C17H13F3O — CID 135307691
4-[4-(3,4-difluorophenyl)-2-fluorophenyl]-2-methylbut-3-yn-2-ol (PubChem CID 135307691) has the molecular formula C17H13F3O and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-[4-(3,4-difluorophenyl)-2-fluorophenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[4-(3,4-difluorophenyl)-2-fluorophenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 135307691 |
| Molecular Formula | C17H13F3O |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-[4-(3,4-difluorophenyl)-2-fluorophenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc(-c2ccc(F)c(F)c2)cc1F |
| InChI | InChI=1S/C17H13F3O/c1-17(2,21)8-7-11-3-4-12(9-15(11)19)13-5-6-14(18)16(20)10-13/h3-6,9-10,21H,1-2H3 |
| InChIKey | BRFPJOGCJFEJFH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|