C19H11F3S — CID 142413524
2-[2-[4-(3,4-difluorophenyl)-2-fluorophenyl]ethynyl]-5-methylthiophene (PubChem CID 142413524) has the molecular formula C19H11F3S and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[2-[4-(3,4-difluorophenyl)-2-fluorophenyl]ethynyl]-5-methylthiophene.
| Compound Name | 2-[2-[4-(3,4-difluorophenyl)-2-fluorophenyl]ethynyl]-5-methylthiophene |
|---|---|
| PubChem CID | 142413524 |
| Molecular Formula | C19H11F3S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[2-[4-(3,4-difluorophenyl)-2-fluorophenyl]ethynyl]-5-methylthiophene |
| SMILES | Cc1ccc(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2F)s1 |
| InChI | InChI=1S/C19H11F3S/c1-12-2-7-16(23-12)8-5-13-3-4-14(10-18(13)21)15-6-9-17(20)19(22)11-15/h2-4,6-7,9-11H,1H3 |
| InChIKey | RCRCUKKHDKPMLS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|