C29H22F2 — CID 134376452
1-fluoro-2-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]-3-methyl-5-(4-methylphenyl)benzene (PubChem CID 134376452) has the molecular formula C29H22F2 and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-fluoro-2-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]-3-methyl-5-(4-methylphenyl)benzene.
| Compound Name | 1-fluoro-2-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]-3-methyl-5-(4-methylphenyl)benzene |
|---|---|
| PubChem CID | 134376452 |
| Molecular Formula | C29H22F2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1-fluoro-2-[2-[2-fluoro-4-(4-methylphenyl)phenyl]ethynyl]-3-methyl-5-(4-methylphenyl)benzene |
| SMILES | Cc1ccc(-c2ccc(C#Cc3c(C)cc(-c4ccc(C)cc4)cc3F)c(F)c2)cc1 |
| InChI | InChI=1S/C29H22F2/c1-19-4-8-22(9-5-19)25-13-12-24(28(30)17-25)14-15-27-21(3)16-26(18-29(27)31)23-10-6-20(2)7-11-23/h4-13,16-18H,1-3H3 |
| InChIKey | BRFFWQBSZCTRDD-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|