C34H32F2 — CID 134371219
2-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-1-fluoro-3-methyl-5-(4-propylphenyl)benzene (PubChem CID 134371219) has the molecular formula C34H32F2 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-1-fluoro-3-methyl-5-(4-propylphenyl)benzene.
| Compound Name | 2-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-1-fluoro-3-methyl-5-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 134371219 |
| Molecular Formula | C34H32F2 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-[2-[4-(4-butylphenyl)-2-fluorophenyl]ethynyl]-1-fluoro-3-methyl-5-(4-propylphenyl)benzene |
| SMILES | CCCCc1ccc(-c2ccc(C#Cc3c(C)cc(-c4ccc(CCC)cc4)cc3F)c(F)c2)cc1 |
| InChI | InChI=1S/C34H32F2/c1-4-6-8-26-11-13-27(14-12-26)30-18-17-29(33(35)22-30)19-20-32-24(3)21-31(23-34(32)36)28-15-9-25(7-5-2)10-16-28/h9-18,21-23H,4-8H2,1-3H3 |
| InChIKey | VVMVZNIXHCUUAJ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|