C36H37FS — CID 134376027
5-(4-butylsulfanylphenyl)-1-fluoro-3-methyl-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethynyl]benzene (PubChem CID 134376027) has the molecular formula C36H37FS and a molecular weight of 520.76 g/mol. Its IUPAC name is 5-(4-butylsulfanylphenyl)-1-fluoro-3-methyl-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethynyl]benzene.
| Compound Name | 5-(4-butylsulfanylphenyl)-1-fluoro-3-methyl-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 134376027 |
| Molecular Formula | C36H37FS |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 5-(4-butylsulfanylphenyl)-1-fluoro-3-methyl-2-[2-[4-[4-(4-methylphenyl)butyl]phenyl]ethynyl]benzene |
| SMILES | CCCCSc1ccc(-c2cc(C)c(C#Cc3ccc(CCCCc4ccc(C)cc4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H37FS/c1-4-5-24-38-34-21-19-32(20-22-34)33-25-28(3)35(36(37)26-33)23-18-31-16-14-30(15-17-31)9-7-6-8-29-12-10-27(2)11-13-29/h10-17,19-22,25-26H,4-9,24H2,1-3H3 |
| InChIKey | SWFZLYRDNLCSLV-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|