C34H32F2O — CID 134371249
5-[4-(4-butyl-2-fluorophenyl)phenyl]-1-fluoro-3-methyl-2-[2-(4-propoxyphenyl)ethynyl]benzene (PubChem CID 134371249) has the molecular formula C34H32F2O and a molecular weight of 494.63 g/mol. Its IUPAC name is 5-[4-(4-butyl-2-fluorophenyl)phenyl]-1-fluoro-3-methyl-2-[2-(4-propoxyphenyl)ethynyl]benzene.
| Compound Name | 5-[4-(4-butyl-2-fluorophenyl)phenyl]-1-fluoro-3-methyl-2-[2-(4-propoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 134371249 |
| Molecular Formula | C34H32F2O |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 5-[4-(4-butyl-2-fluorophenyl)phenyl]-1-fluoro-3-methyl-2-[2-(4-propoxyphenyl)ethynyl]benzene |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(C)c(C#Cc4ccc(OCCC)cc4)c(F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C34H32F2O/c1-4-6-7-26-11-19-32(33(35)22-26)28-14-12-27(13-15-28)29-21-24(3)31(34(36)23-29)18-10-25-8-16-30(17-9-25)37-20-5-2/h8-9,11-17,19,21-23H,4-7,20H2,1-3H3 |
| InChIKey | YOGJBNRZRQQILI-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|