C33H30F2O — CID 134375901
5-butoxy-1-ethyl-3-fluoro-2-[2-[4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]ethynyl]benzene (PubChem CID 134375901) has the molecular formula C33H30F2O and a molecular weight of 480.60 g/mol. Its IUPAC name is 5-butoxy-1-ethyl-3-fluoro-2-[2-[4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]ethynyl]benzene.
| Compound Name | 5-butoxy-1-ethyl-3-fluoro-2-[2-[4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 134375901 |
| Molecular Formula | C33H30F2O |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 5-butoxy-1-ethyl-3-fluoro-2-[2-[4-[2-fluoro-4-(4-methylphenyl)phenyl]phenyl]ethynyl]benzene |
| SMILES | CCCCOc1cc(F)c(C#Cc2ccc(-c3ccc(-c4ccc(C)cc4)cc3F)cc2)c(CC)c1 |
| InChI | InChI=1S/C33H30F2O/c1-4-6-19-36-29-20-25(5-2)30(33(35)22-29)17-11-24-9-14-27(15-10-24)31-18-16-28(21-32(31)34)26-12-7-23(3)8-13-26/h7-10,12-16,18,20-22H,4-6,19H2,1-3H3 |
| InChIKey | OCLDUKIRDVUXFA-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|