C37H25F7 — CID 134371362
5-[4-(4-butylphenyl)-2-fluorophenyl]-2-[2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]ethynyl]-1-fluoro-3-methylbenzene (PubChem CID 134371362) has the molecular formula C37H25F7 and a molecular weight of 602.59 g/mol. Its IUPAC name is 5-[4-(4-butylphenyl)-2-fluorophenyl]-2-[2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]ethynyl]-1-fluoro-3-methylbenzene.
| Compound Name | 5-[4-(4-butylphenyl)-2-fluorophenyl]-2-[2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]ethynyl]-1-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 134371362 |
| Molecular Formula | C37H25F7 |
| Molecular Weight | 602.59 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 5-[4-(4-butylphenyl)-2-fluorophenyl]-2-[2-[3,5-difluoro-4-(3,4,5-trifluorophenyl)phenyl]ethynyl]-1-fluoro-3-methylbenzene |
| SMILES | CCCCc1ccc(-c2ccc(-c3cc(C)c(C#Cc4cc(F)c(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C37H25F7/c1-3-4-5-22-6-9-24(10-7-22)25-11-13-29(31(39)17-25)26-14-21(2)28(30(38)18-26)12-8-23-15-32(40)36(33(41)16-23)27-19-34(42)37(44)35(43)20-27/h6-7,9-11,13-20H,3-5H2,1-2H3 |
| InChIKey | FPSVXLBIJDNUDJ-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.59 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|