C33H16F8 — CID 134377894
1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluorophenyl)phenyl]-6-methylphenyl]ethynyl]-2-(3,4,5-trifluorophenyl)benzene (PubChem CID 134377894) has the molecular formula C33H16F8 and a molecular weight of 564.48 g/mol. Its IUPAC name is 1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluorophenyl)phenyl]-6-methylphenyl]ethynyl]-2-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluorophenyl)phenyl]-6-methylphenyl]ethynyl]-2-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 134377894 |
| Molecular Formula | C33H16F8 |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 1,3-difluoro-5-[2-[2-fluoro-4-[2-fluoro-4-(2-fluorophenyl)phenyl]-6-methylphenyl]ethynyl]-2-(3,4,5-trifluorophenyl)benzene |
| SMILES | Cc1cc(-c2ccc(-c3ccccc3F)cc2F)cc(F)c1C#Cc1cc(F)c(-c2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C33H16F8/c1-17-10-20(24-9-7-19(13-27(24)36)23-4-2-3-5-25(23)34)14-26(35)22(17)8-6-18-11-28(37)32(29(38)12-18)21-15-30(39)33(41)31(40)16-21/h2-5,7,9-16H,1H3 |
| InChIKey | BFJTYSCGJSDYDK-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|