C34H20F6 — CID 134376185
1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[2-fluoro-6-methyl-4-(4-methylphenyl)phenyl]ethynyl]phenyl]phenyl]benzene (PubChem CID 134376185) has the molecular formula C34H20F6 and a molecular weight of 542.52 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[2-fluoro-6-methyl-4-(4-methylphenyl)phenyl]ethynyl]phenyl]phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[2-fluoro-6-methyl-4-(4-methylphenyl)phenyl]ethynyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 134376185 |
| Molecular Formula | C34H20F6 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-[2-fluoro-4-[2-[2-fluoro-6-methyl-4-(4-methylphenyl)phenyl]ethynyl]phenyl]phenyl]benzene |
| SMILES | Cc1ccc(-c2cc(C)c(C#Cc3ccc(-c4ccc(-c5cc(F)c(F)c(F)c5)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C34H20F6/c1-19-3-7-22(8-4-19)24-13-20(2)26(30(36)16-24)10-5-21-6-11-27(29(35)14-21)23-9-12-28(31(37)15-23)25-17-32(38)34(40)33(39)18-25/h3-4,6-9,11-18H,1-2H3 |
| InChIKey | LSNRDTQEICCTLT-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|