C27H27F3 — CID 142320887
1-[2-(4-butyl-2-methylphenyl)ethynyl]-4-(3,4-difluorophenyl)-2-fluorobenzene;ethane (PubChem CID 142320887) has the molecular formula C27H27F3 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[2-(4-butyl-2-methylphenyl)ethynyl]-4-(3,4-difluorophenyl)-2-fluorobenzene;ethane.
| Compound Name | 1-[2-(4-butyl-2-methylphenyl)ethynyl]-4-(3,4-difluorophenyl)-2-fluorobenzene;ethane |
|---|---|
| PubChem CID | 142320887 |
| Molecular Formula | C27H27F3 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 1-[2-(4-butyl-2-methylphenyl)ethynyl]-4-(3,4-difluorophenyl)-2-fluorobenzene;ethane |
| SMILES | CC.CCCCc1ccc(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2F)c(C)c1 |
| InChI | InChI=1S/C25H21F3.C2H6/c1-3-4-5-18-6-7-19(17(2)14-18)8-9-20-10-11-21(15-24(20)27)22-12-13-23(26)25(28)16-22;1-2/h6-7,10-16H,3-5H2,1-2H3;1-2H3 |
| InChIKey | MKHSLDMRYPAZBG-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|