C27H26F2 — CID 142320877
2-fluoro-1-(3-fluoro-4-methylphenyl)-4-[2-(2-methyl-4-pentylphenyl)ethynyl]benzene (PubChem CID 142320877) has the molecular formula C27H26F2 and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-fluoro-1-(3-fluoro-4-methylphenyl)-4-[2-(2-methyl-4-pentylphenyl)ethynyl]benzene.
| Compound Name | 2-fluoro-1-(3-fluoro-4-methylphenyl)-4-[2-(2-methyl-4-pentylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 142320877 |
| Molecular Formula | C27H26F2 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-fluoro-1-(3-fluoro-4-methylphenyl)-4-[2-(2-methyl-4-pentylphenyl)ethynyl]benzene |
| SMILES | CCCCCc1ccc(C#Cc2ccc(-c3ccc(C)c(F)c3)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C27H26F2/c1-4-5-6-7-21-9-13-23(20(3)16-21)14-10-22-11-15-25(27(29)17-22)24-12-8-19(2)26(28)18-24/h8-9,11-13,15-18H,4-7H2,1-3H3 |
| InChIKey | SQPCQTFNBPRIDA-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|