C26H23F3 — CID 134415370
1,2-difluoro-4-[2-fluoro-4-[2-(2-methyl-4-pentylphenyl)ethynyl]phenyl]benzene (PubChem CID 134415370) has the molecular formula C26H23F3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1,2-difluoro-4-[2-fluoro-4-[2-(2-methyl-4-pentylphenyl)ethynyl]phenyl]benzene.
| Compound Name | 1,2-difluoro-4-[2-fluoro-4-[2-(2-methyl-4-pentylphenyl)ethynyl]phenyl]benzene |
|---|---|
| PubChem CID | 134415370 |
| Molecular Formula | C26H23F3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1,2-difluoro-4-[2-fluoro-4-[2-(2-methyl-4-pentylphenyl)ethynyl]phenyl]benzene |
| SMILES | CCCCCc1ccc(C#Cc2ccc(-c3ccc(F)c(F)c3)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C26H23F3/c1-3-4-5-6-19-7-10-21(18(2)15-19)11-8-20-9-13-23(25(28)16-20)22-12-14-24(27)26(29)17-22/h7,9-10,12-17H,3-6H2,1-2H3 |
| InChIKey | CPCBBSAAPFUVIQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|