C12H12F2 — CID 139945533
5,6-difluoro-2-propyl-1H-indene (PubChem CID 139945533) has the molecular formula C12H12F2 and a molecular weight of 194.22 g/mol. Its IUPAC name is 5,6-difluoro-2-propyl-1H-indene.
| Compound Name | 5,6-difluoro-2-propyl-1H-indene |
|---|---|
| PubChem CID | 139945533 |
| Molecular Formula | C12H12F2 |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5,6-difluoro-2-propyl-1H-indene |
| SMILES | CCCC1=Cc2cc(F)c(F)cc2C1 |
| InChI | InChI=1S/C12H12F2/c1-2-3-8-4-9-6-11(13)12(14)7-10(9)5-8/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | LZIBYIXRHXUBRY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |