C26H28F4 — CID 139967120
2-[2,6-difluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-5,6-difluoro-1H-indene (PubChem CID 139967120) has the molecular formula C26H28F4 and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-5,6-difluoro-1H-indene.
| Compound Name | 2-[2,6-difluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-5,6-difluoro-1H-indene |
|---|---|
| PubChem CID | 139967120 |
| Molecular Formula | C26H28F4 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[2,6-difluoro-4-[2-(4-propylcyclohexyl)ethyl]phenyl]-5,6-difluoro-1H-indene |
| SMILES | CCCC1CCC(CCc2cc(F)c(C3=Cc4cc(F)c(F)cc4C3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H28F4/c1-2-3-16-4-6-17(7-5-16)8-9-18-10-24(29)26(25(30)11-18)21-12-19-14-22(27)23(28)15-20(19)13-21/h10-12,14-17H,2-9,13H2,1H3 |
| InChIKey | LTGJOZSWJZUPSG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|