C25H24F6O — CID 139967190
2-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1H-indene (PubChem CID 139967190) has the molecular formula C25H24F6O and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1H-indene.
| Compound Name | 2-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1H-indene |
|---|---|
| PubChem CID | 139967190 |
| Molecular Formula | C25H24F6O |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-5-fluoro-6-(trifluoromethoxy)-1H-indene |
| SMILES | CCCC1CCC(c2cc(F)c(C3=Cc4cc(F)c(OC(F)(F)F)cc4C3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H24F6O/c1-2-3-14-4-6-15(7-5-14)18-11-21(27)24(22(28)12-18)19-8-16-10-20(26)23(13-17(16)9-19)32-25(29,30)31/h8,10-15H,2-7,9H2,1H3 |
| InChIKey | CKQYQKJHYKXJSP-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|