C26H26F3N — CID 139961405
6-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-3-fluoro-7,8-dihydronaphthalene-2-carbonitrile (PubChem CID 139961405) has the molecular formula C26H26F3N and a molecular weight of 409.50 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-3-fluoro-7,8-dihydronaphthalene-2-carbonitrile.
| Compound Name | 6-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-3-fluoro-7,8-dihydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139961405 |
| Molecular Formula | C26H26F3N |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 6-[2,6-difluoro-4-(4-propylcyclohexyl)phenyl]-3-fluoro-7,8-dihydronaphthalene-2-carbonitrile |
| SMILES | CCCC1CCC(c2cc(F)c(C3=Cc4cc(F)c(C#N)cc4CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H26F3N/c1-2-3-16-4-6-17(7-5-16)21-13-24(28)26(25(29)14-21)19-9-8-18-10-22(15-30)23(27)12-20(18)11-19/h10-14,16-17H,2-9H2,1H3 |
| InChIKey | ORZLEXCNDKWSMF-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|