C26H26F4 — CID 139967142
2-[2,6-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene (PubChem CID 139967142) has the molecular formula C26H26F4 and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene.
| Compound Name | 2-[2,6-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene |
|---|---|
| PubChem CID | 139967142 |
| Molecular Formula | C26H26F4 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-[2,6-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene |
| SMILES | C/C=C/CCC1CCC(c2cc(F)c(C3=Cc4cc(F)c(F)cc4C3)c(F)c2)CC1 |
| InChI | InChI=1S/C26H26F4/c1-2-3-4-5-16-6-8-17(9-7-16)20-14-24(29)26(25(30)15-20)21-10-18-12-22(27)23(28)13-19(18)11-21/h2-3,10,12-17H,4-9,11H2,1H3/b3-2+ |
| InChIKey | AFEJIBCANZMTLD-NSCUHMNNSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|