C24H22F4 — CID 139967156
2-[2,6-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene (PubChem CID 139967156) has the molecular formula C24H22F4 and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene.
| Compound Name | 2-[2,6-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene |
|---|---|
| PubChem CID | 139967156 |
| Molecular Formula | C24H22F4 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[2,6-difluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]-5,6-difluoro-1H-indene |
| SMILES | C/C=C/C1CCC(c2cc(F)c(C3=Cc4cc(F)c(F)cc4C3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H22F4/c1-2-3-14-4-6-15(7-5-14)18-12-22(27)24(23(28)13-18)19-8-16-10-20(25)21(26)11-17(16)9-19/h2-3,8,10-15H,4-7,9H2,1H3/b3-2+ |
| InChIKey | STISCXFCTZOFMH-NSCUHMNNSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|