C18H18FN — CID 22967474
3-[2-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]prop-2-ynenitrile (PubChem CID 22967474) has the molecular formula C18H18FN and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-[2-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]prop-2-ynenitrile.
| Compound Name | 3-[2-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]prop-2-ynenitrile |
|---|---|
| PubChem CID | 22967474 |
| Molecular Formula | C18H18FN |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-[2-fluoro-4-[4-[(E)-prop-1-enyl]cyclohexyl]phenyl]prop-2-ynenitrile |
| SMILES | C/C=C/C1CCC(c2ccc(C#CC#N)c(F)c2)CC1 |
| InChI | InChI=1S/C18H18FN/c1-2-4-14-6-8-15(9-7-14)17-11-10-16(5-3-12-20)18(19)13-17/h2,4,10-11,13-15H,6-9H2,1H3/b4-2+ |
| InChIKey | MBMVIHWQKYHZNA-DUXPYHPUSA-N |
| XLogP | 4.55 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|