C19H24FN — CID 54394190
2-fluoro-4-(4-hex-1-enylcyclohexyl)benzonitrile (PubChem CID 54394190) has the molecular formula C19H24FN and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-fluoro-4-(4-hex-1-enylcyclohexyl)benzonitrile.
| Compound Name | 2-fluoro-4-(4-hex-1-enylcyclohexyl)benzonitrile |
|---|---|
| PubChem CID | 54394190 |
| Molecular Formula | C19H24FN |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-fluoro-4-(4-hex-1-enylcyclohexyl)benzonitrile |
| SMILES | CCCCC=CC1CCC(c2ccc(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C19H24FN/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-12-18(14-21)19(20)13-17/h5-6,11-13,15-16H,2-4,7-10H2,1H3 |
| InChIKey | VITRQBOKYCSXFR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|