C34H45F3 — CID 20621677
1-butyl-2,3-difluoro-4-[2-fluoro-4-[4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexyl]phenyl]benzene (PubChem CID 20621677) has the molecular formula C34H45F3 and a molecular weight of 510.73 g/mol. Its IUPAC name is 1-butyl-2,3-difluoro-4-[2-fluoro-4-[4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexyl]phenyl]benzene.
| Compound Name | 1-butyl-2,3-difluoro-4-[2-fluoro-4-[4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexyl]phenyl]benzene |
|---|---|
| PubChem CID | 20621677 |
| Molecular Formula | C34H45F3 |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 1-butyl-2,3-difluoro-4-[2-fluoro-4-[4-[4-[(E)-hex-1-enyl]cyclohexyl]cyclohexyl]phenyl]benzene |
| SMILES | CCCC/C=C/C1CCC(C2CCC(c3ccc(-c4ccc(CCCC)c(F)c4F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C34H45F3/c1-3-5-7-8-9-24-11-13-25(14-12-24)26-15-17-27(18-16-26)29-20-21-30(32(35)23-29)31-22-19-28(10-6-4-2)33(36)34(31)37/h8-9,19-27H,3-7,10-18H2,1-2H3/b9-8+ |
| InChIKey | XZSCBHOYXVTNGE-CMDGGOBGSA-N |
| XLogP | 10.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|