C23H27F3O2 — CID 126764887
5-[4-(4-butyl-2,3-difluorophenyl)-3-fluorophenyl]-2-ethoxyoxane (PubChem CID 126764887) has the molecular formula C23H27F3O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-[4-(4-butyl-2,3-difluorophenyl)-3-fluorophenyl]-2-ethoxyoxane.
| Compound Name | 5-[4-(4-butyl-2,3-difluorophenyl)-3-fluorophenyl]-2-ethoxyoxane |
|---|---|
| PubChem CID | 126764887 |
| Molecular Formula | C23H27F3O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 5-[4-(4-butyl-2,3-difluorophenyl)-3-fluorophenyl]-2-ethoxyoxane |
| SMILES | CCCCc1ccc(-c2ccc(C3CCC(OCC)OC3)cc2F)c(F)c1F |
| InChI | InChI=1S/C23H27F3O2/c1-3-5-6-15-7-11-19(23(26)22(15)25)18-10-8-16(13-20(18)24)17-9-12-21(27-4-2)28-14-17/h7-8,10-11,13,17,21H,3-6,9,12,14H2,1-2H3 |
| InChIKey | ADSVQBORPMZWOD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |