C25H31F3O — CID 126764861
5-[4-(4-ethyl-2,3-difluorophenyl)-3-fluorophenyl]-2-hexyloxane (PubChem CID 126764861) has the molecular formula C25H31F3O and a molecular weight of 404.52 g/mol. Its IUPAC name is 5-[4-(4-ethyl-2,3-difluorophenyl)-3-fluorophenyl]-2-hexyloxane.
| Compound Name | 5-[4-(4-ethyl-2,3-difluorophenyl)-3-fluorophenyl]-2-hexyloxane |
|---|---|
| PubChem CID | 126764861 |
| Molecular Formula | C25H31F3O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 5-[4-(4-ethyl-2,3-difluorophenyl)-3-fluorophenyl]-2-hexyloxane |
| SMILES | CCCCCCC1CCC(c2ccc(-c3ccc(CC)c(F)c3F)c(F)c2)CO1 |
| InChI | InChI=1S/C25H31F3O/c1-3-5-6-7-8-20-12-9-19(16-29-20)18-11-13-21(23(26)15-18)22-14-10-17(4-2)24(27)25(22)28/h10-11,13-15,19-20H,3-9,12,16H2,1-2H3 |
| InChIKey | RSASBHVVQGICDB-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|