C17H19F2N — CID 67590309
2-fluoro-4-[4-[(E)-4-fluorobut-2-enyl]cyclohexyl]benzonitrile (PubChem CID 67590309) has the molecular formula C17H19F2N and a molecular weight of 275.34 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(E)-4-fluorobut-2-enyl]cyclohexyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[(E)-4-fluorobut-2-enyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 67590309 |
| Molecular Formula | C17H19F2N |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-fluoro-4-[4-[(E)-4-fluorobut-2-enyl]cyclohexyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CCC(C/C=C/CF)CC2)cc1F |
| InChI | InChI=1S/C17H19F2N/c18-10-2-1-3-13-4-6-14(7-5-13)15-8-9-16(12-20)17(19)11-15/h1-2,8-9,11,13-14H,3-7,10H2/b2-1+ |
| InChIKey | WKONAOGBYKJJCK-OWOJBTEDSA-N |
| XLogP | 4.89 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|