C25H26F3NO — CID 67593665
4-[difluoro-[4-[4-[(Z)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2-fluorobenzonitrile (PubChem CID 67593665) has the molecular formula C25H26F3NO and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-[difluoro-[4-[4-[(Z)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2-fluorobenzonitrile.
| Compound Name | 4-[difluoro-[4-[4-[(Z)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 67593665 |
| Molecular Formula | C25H26F3NO |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-[difluoro-[4-[4-[(Z)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2-fluorobenzonitrile |
| SMILES | CC/C=C\CC1CCC(c2ccc(C(F)(F)Oc3ccc(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H26F3NO/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-13-22(14-11-20)25(27,28)30-23-15-12-21(17-29)24(26)16-23/h3-4,10-16,18-19H,2,5-9H2,1H3/b4-3- |
| InChIKey | FMJGKFRRSICFRQ-ARJAWSKDSA-N |
| XLogP | 7.46 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|