C25H28F4O2 — CID 20576251
1-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenoxy]methyl]-2,3-difluoro-4-methoxybenzene (PubChem CID 20576251) has the molecular formula C25H28F4O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenoxy]methyl]-2,3-difluoro-4-methoxybenzene.
| Compound Name | 1-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenoxy]methyl]-2,3-difluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 20576251 |
| Molecular Formula | C25H28F4O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenoxy]methyl]-2,3-difluoro-4-methoxybenzene |
| SMILES | CC/C=C/CC1CCC(c2ccc(OC(F)(F)c3ccc(OC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C25H28F4O2/c1-3-4-5-6-17-7-9-18(10-8-17)19-11-13-20(14-12-19)31-25(28,29)21-15-16-22(30-2)24(27)23(21)26/h4-5,11-18H,3,6-10H2,1-2H3/b5-4+ |
| InChIKey | DGJIUYRKFGSDHD-SNAWJCMRSA-N |
| XLogP | 7.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|