C25H25F4NO — CID 70176379
4-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2,6-difluorobenzonitrile (PubChem CID 70176379) has the molecular formula C25H25F4NO and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2,6-difluorobenzonitrile.
| Compound Name | 4-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 70176379 |
| Molecular Formula | C25H25F4NO |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 4-[difluoro-[4-[4-[(E)-pent-2-enyl]cyclohexyl]phenyl]methoxy]-2,6-difluorobenzonitrile |
| SMILES | CC/C=C/CC1CCC(c2ccc(C(F)(F)Oc3cc(F)c(C#N)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H25F4NO/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)25(28,29)31-21-14-23(26)22(16-30)24(27)15-21/h3-4,10-15,17-18H,2,5-9H2,1H3/b4-3+ |
| InChIKey | PBDVGUOQXIAPAQ-ONEGZZNKSA-N |
| XLogP | 7.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|